>I2Overcome: removed category

2025-03-11T07:15:39Z

removed category

New page

{{Documentation subpage}}
{{Lua|Module:Infobox|Module:InfoboxImage|Module:If preview|Module:Check for unknown parameters}}

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

{{Parameter names example|_template=
| 2V | absorption | alt | alteration | birefringence | boxbgcolor | boxtextcolor | boxwidth | caption | category | class | cleavage | color
| colour | dana | density | diagnostic | diaphaneity | dispersion | extinction | fluorescence | formula | fracture | fusibility | gravity
| habit | image | imagesize | IMAsymbol | impurities | Jmol | length fast/slow | luster | lustre | melt | mohs | molweight | name
| opticalprop | other | piezo | pleochroism | polish lustre | polish | prop1 | prop1text | references | refractive | SMILES | solubility
| streak | struct alt | struct caption | struct image | struct imagesize | struct2 alt | struct2 caption | struct2 image | struct2 imagesize
| strunz | symmetry | system | tenacity | twinning | unit cell | var1 | var1text | var2 | var2text | var3 | var3text | var4 | var4text
| var5 | var5text | var6 | var6text }}

== Usage ==
Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.
{{Infobox mineral
| name = Ruby
| boxwidth =
| boxbgcolor = pink
| boxtextcolor = black
| image = Ruby cristal.jpg
| imagesize = 151
| alt =
| caption = A naturally occurring ruby crystal
| category = [[Oxide minerals|Oxide]] [[minerals]], [[corundum]] [[Mineral variety|variety]]
| formula = [[aluminium oxide]] with [[chromium]], Al2O3:Cr
| IMAsymbol =
| molweight =
| strunz =
| dana =
| system = [[Trigonal]]
| class = Hexagonal scalenohedral ({{overline|3}}m) [[H-M symbol]]: ({{overline|3}} 2/m)
| symmetry = ''R''{{overline|3}}c (No. 167)
| unit cell = unit cell
| color = Red, may be brownish, purplish or pinkish
| colour =
| habit = Varies with locality. Terminated tabular hexagonal prisms.
| twinning =
| cleavage = No true cleavage
| fracture = Uneven or conchoidal
| tenacity =
| mohs = 9.0
| luster = Vitreous
| streak = white
| diaphaneity = transparent
| gravity = 4.0
| density =
| polish =
| opticalprop =
| refractive = nω=1.768 - 1.772 nε=1.760 - 1.763, [[Birefringence]] 0.008
| birefringence =
| pleochroism = Orangey red, purplish red
| 2V =
| dispersion =
| extinction =
| length fast/slow =
| fluorescence = red under longwave
| absorption =
| melt = 2044 °C
| fusibility =
| diagnostic =
| solubility = none
| impurities =
| alteration =
| other =
| prop1 =
| prop1text =
| references =
| var1 = [[Sapphire]]
| var1text = Any color except red and violet
| var2 = Oriental amethyst
| var2text = violet color
| var3 = [[Corundum]]
| var3text = various colors (mineral species)
| var4 = [[Emery (mineral)|Emery]]
| var4text = Granular (mineral mixture)
| var5 =
| var5text =
| var6 =
| var6text =
}}

<syntaxhighlight lang="wikitext">
{{Infobox mineral
| name =
| boxwidth =
| boxbgcolor =
| image =
| imagesize =
| alt =
| caption =
| struct image =
| struct caption =
| struct imagesize =
| struct2 image =
| struct2 caption =
| struct2 imagesize=
| SMILES =
| Jmol =
| category =
| formula =
| IMAsymbol =
| molweight =
| strunz =
| dana =
| system =
| class =
| symmetry =
| unit cell =
| color =
| colour =
| habit =
| twinning =
| cleavage =
| fracture =
| tenacity =
| mohs =
| luster =
| streak =
| diaphaneity =
| gravity =
| density =
| polish =
| opticalprop =
| refractive =
| birefringence =
| pleochroism =
| 2V =
| dispersion =
| extinction =
| length fast/slow =
| fluorescence =
| absorption =
| melt =
| Curie temp =
| fusibility =
| diagnostic =
| solubility =
| impurities =
| alteration =
| other =
| prop1 =
| prop1text =
| references =
| var1 =
| var1text =
| var2 =
| var2text =
| var3 =
| var3text =
| var4 =
| var4text =
| var5 =
| var5text =
| var6 =
| var6text =
}}
</syntaxhighlight>

===All parameters used===
{{infobox mineral
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| IMAsymbol = IMAsymbol
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text
}}
<syntaxhighlight lang="wikitext">
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| IMAsymbol = IMAsymbol
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text
</syntaxhighlight>

== Description ==
This should describe the parameters used in this template.

{| class="wikitable"
|-
! Parameter !! Explanation !! Example
|-
!name
| [[International Mineralogical Association|IMA]] mineral name (if there is another common name, put it in parentheses) || Baryte (Barite)
|-
!boxwidth
| ||
|-
!boxbgcolor
| Background color of box headers ||
|-
!boxtextcolor
| Text color of box headers ||
|-
!image
| Wikimedia Commons image filename (to go at top) || Epidoto.jpeg
|-
!imagesize
| ||
|-
!alt
| alt text for image, for visually impaired readers; see [[WP:ALT]] || Agglomeration of dark cylindrical crystals
|-
!caption
| image caption || Epidote crystals
|-
!category
| list broadest mineral group first (capitalized), followed by "minerals" (plural), then other groups, subgroups, and/or series name (if applicable), then mineral species name (if article topic is a mineral variety); separate with commas; add links manually for each category and the first occurrences of the words: "minerals", "group" or "subgroup" (link to [[Mineral group]]), "variety" (link to [[Mineral variety]]) (template does not auto-link)
||For [[Fairburn Agate]]: <nowiki>[[Tectosilicate]] [[minerals]], [[quartz]] [[Mineral group|group]], [[chalcedony]] [[Mineral variety|variety]], [[agate]] variety</nowiki>
|-
!formula
| [[formula unit|chemical formula]] giving the elemental composition of the mineral, or a generic formula for a mineral group; use {{chem2}} for complex formulas
|| BaSO4
|-
!IMAsymbol
| [[List of mineral symbols|IMA symbol]] of the mineral || Brt
|-
!strunz
| [[Nickel-Strunz classification]] of the mineral (10 ed, MinDat) || 9.BG.05
|-
!dana
| [[Dana classification]] of the mineral || 28.03.01.01
|-
!symmetry
| [[Hermann–Mauguin notation]] of the mineral's symmetry element, labeled: [[Space group]] ||
|-
!unit cell
| [[Unit cell]] dimensions and number (Z) of [[formula unit]]s per unit cell ||
|-
!molweight
| [[molar mass]] of the chemical formula above||
|-
!color
| common [[Mineral#Colour_and_streak|colors of the mineral]] ||
|-
!colour
| same as above, but for British pages ||
|-
!habit
| common [[mineral habit]] ||
|-
!system
| [[crystal system]] ([[cubic crystal system|cubic]], etc.) ||
|-
!class
| [[crystal class]] ||
|-
!twinning
|common type of [[Crystal twinning|twinning]] ||
|-
!cleavage
| type of [[Cleavage (mineralogy)|cleavage]] ||
|-
!fracture
| type of [[Fracture (mineralogy)|fracture]] (appearance of broken surface)|| irregular
|-
!tenacity
| [[Tenacity (mineralogy)|tenacity]] (how the mineral can deform or break) || brittle
|-
!mohs
| hardness (scratchability) of mineral on [[Mohs hardness scale]] || 3-3.5
|-
!luster
| way the mineral reflects light, see [[Lustre (mineralogy)|luster]] ||
|-
!lustre
| same as above, but for British pages ||
|-
!streak
| see [[streak (mineralogy)|streak]] ||
|-
!diaphaneity
| [[transparency (optics)|transparency]] of mineral ||
|-
!gravity
| [[specific gravity]] ||
|-
!density
| density at [[Standard temperature and pressure|STP]] in g/cm3||
|-
!polish
| ability to take a [[Polishing|polish]] ||
|-
!opticalprop
| ||
|-
!refractive
| [[refractive index]] of mineral ||
|-
!birefringence
| [[birefringence]] of a 30micron thin section ||
|-
!pleochroism
| see [[pleochroism]] ||
|-
!2V
| [[2V angle]] ||
|-
!dispersion
| see [[Dispersion (optics)|dispersion]] ||
|-
!extinction
| [[extinction angle]], e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals). ||
|-
!length fast/slow
| [[Sign of elongation]]: length fast or length slow ||
|-
!fluorescence
| see [[fluorescence]] ||
|-
!absorption
| see [[Absorption (electromagnetic radiation)|absorption]] ||
|-
!melt
| [[melting point]] of mineral ||
|-
!Curie
| [[Curie temperature]] of mineral ||
|-
!fusibility
| [[fusibility]] of mineral ||
|-
!diagnostic
| key way to recognize mineral ||
|-
!solubility
| [[solubility]] of mineral in water at [[Standard temperature and pressure|STP]] ||
|-
!impurities
| common impurities ||
|-
!alteration
| [[Mineral alteration|alteration]] products ||
|-
!other
| ||
|-
!prop1
| ||
|-
!prop1text
| ||
|-
!references
| use the Wikipedia [[template:ref]] to cite || References supporting the properties to be added at that line using <nowiki><ref>...</ref></nowiki> tag notation. Individual items can be tagged separately if needed.
|-
!var1
| ||
|-
!var1text
| ||
|-
!var2
| ||
|-
!var2text
| ||
|-
!var3
| ||
|-
!var3text
| ||
|-
!var4
| ||
|-
!var4text
| ||
|-
!var5
| ||
|-
!var5text
| ||
|-
!var6
| ||
|-
!var6text
| ||
|}

==TemplateData==
{{TemplateData header}}
<templatedata>
{
"params": {
"boxwidth": {},
"boxtextcolor": {},
"boxbgcolor": {},
"name": {},
"image": {},
"imagesize": {},
"alt": {},
"caption": {},
"category": {},
"formula": {},
"IMAsymbol": {},
"strunz": {},
"system": {},
"dana": {},
"class": {},
"symmetry": {},
"unit cell": {},
"molweight": {},
"color": {},
"habit": {},
"twinning": {},
"cleavage": {},
"fracture": {},
"tenacity": {},
"mohs": {},
"luster": {},
"polish": {},
"opticalprop": {},
"refractive": {},
"birefringence": {},
"pleochroism": {},
"2V": {},
"dispersion": {},
"extinction": {},
"length fast/slow": {},
"fluorescence": {},
"absorption": {},
"streak": {},
"gravity": {},
"density": {},
"melt": {},
"fusibility": {},
"diagnostic": {},
"solubility": {},
"diaphaneity": {},
"impurities": {},
"alteration": {},
"other": {},
"prop1text": {},
"references": {},
"colour": {},
"lustre": {},
"polish lustre": {},
"prop1": {},
"var1": {},
"var1text": {},
"var2": {},
"var2text": {},
"var3": {},
"var3text": {},
"var4": {},
"var4text": {},
"var5": {},
"var5text": {},
"var6": {},
"var6text": {},
"struct image": {},
"struct2 image": {},
"SMILES": {},
"Jmol": {},
"struct imagesize": {},
"struct alt": {},
"struct caption": {},
"struct2 imagesize": {},
"struct2 alt": {},
"struct2 caption": {},
"piezo": {}
},
"paramOrder": [
"boxwidth",
"boxtextcolor",
"boxbgcolor",
"name",
"image",
"imagesize",
"alt",
"caption",
"category",
"formula",
"IMAsymbol",
"strunz",
"system",
"dana",
"class",
"symmetry",
"unit cell",
"molweight",
"color",
"habit",
"twinning",
"cleavage",
"fracture",
"tenacity",
"mohs",
"luster",
"polish",
"opticalprop",
"refractive",
"birefringence",
"pleochroism",
"2V",
"dispersion",
"extinction",
"length fast/slow",
"fluorescence",
"absorption",
"streak",
"gravity",
"density",
"melt",
"fusibility",
"diagnostic",
"solubility",
"diaphaneity",
"impurities",
"alteration",
"other",
"prop1text",
"references",
"colour",
"lustre",
"polish lustre",
"prop1",
"var1",
"var1text",
"var2",
"var2text",
"var3",
"var3text",
"var4",
"var4text",
"var5",
"var5text",
"var6",
"var6text",
"struct image",
"struct2 image",
"struct caption",
"struct imagesize",
"struct alt",
"struct2 imagesize",
"struct2 caption",
"struct2 alt",
"Jmol",
"SMILES",
"piezo"
]
}
</templatedata>

== Tracking category ==
* {{clc|Pages using Infobox mineral with unknown parameters}}

<includeonly>{{sandbox other||
[[Category:Geology infobox templates|Mineral]]
[[Category:Templates that add a tracking category|{{PAGENAME}}]]
}}</includeonly>

Template:Infobox mineral/doc - Revision history

>I2Overcome: removed category